6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride

C5H10ClN2S- — CID 51371097

IUPAC6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride
SMILESCC1CCN=C(N)S1.[Cl-]
InChIInChI=1S/C5H10N2S.ClH/c1-4-2-3-7-5(6)8-4;/h4H,2-3H2,1H3,(H2,6,7);1H/p-1
InChIKeyHVJCRMIQAMEJNM-UHFFFAOYSA-M
MW165.67 g/mol
LogP-2.17
Rot. Bonds

About 6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride

6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride (PubChem CID 51371097) has the molecular formula C5H10ClN2S- and a molecular weight of 165.67 g/mol. Its IUPAC name is 6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride.

Molecular Properties

Compound Name6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride
PubChem CID51371097
Molecular FormulaC5H10ClN2S-
Molecular Weight165.67 g/mol
Exact Mass165.03
IUPAC Name6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride
SMILESCC1CCN=C(N)S1.[Cl-]
InChIInChI=1S/C5H10N2S.ClH/c1-4-2-3-7-5(6)8-4;/h4H,2-3H2,1H3,(H2,6,7);1H/p-1
InChIKeyHVJCRMIQAMEJNM-UHFFFAOYSA-M
XLogP-2.17
TPSA38.38 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500165.67
LogP ≤ 5-2.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride?
The IUPAC name of 6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride (CID 51371097) is 6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride.
What is the SMILES notation for 6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride?
The canonical SMILES for 6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride is CC1CCN=C(N)S1.[Cl-].
What is the InChIKey of 6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride?
The InChIKey is HVJCRMIQAMEJNM-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10N2S.ClH/c1-4-2-3-7-5(6)8-4;/h4H,2-3H2,1H3,(H2,6,7);1H/p-1.
What are the key properties of 6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride?
6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride has a molecular weight of 165.67 g/mol, XLogP of -2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5,6-dihydro-4H-1,3-thiazin-2-amine chloride is sourced from PubChem (CID 51371097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).