About (5S)-5H-chromeno[2,3-b]pyridin-5-ol
(5S)-5H-chromeno[2,3-b]pyridin-5-ol (PubChem CID 51374273) has the molecular formula C12H9NO2
and a molecular weight of 199.21 g/mol. Its IUPAC name is (5S)-5H-chromeno[2,3-b]pyridin-5-ol.
Molecular Properties
| Compound Name | (5S)-5H-chromeno[2,3-b]pyridin-5-ol |
| PubChem CID | 51374273 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | (5S)-5H-chromeno[2,3-b]pyridin-5-ol |
| SMILES | O[C@H]1c2ccccc2Oc2ncccc21 |
| InChI | InChI=1S/C12H9NO2/c14-11-8-4-1-2-6-10(8)15-12-9(11)5-3-7-13-12/h1-7,11,14H/t11-/m0/s1 |
| InChIKey | CAOGEKWDLGLKQK-NSHDSACASA-N |
| XLogP | 2.27 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5H-chromeno[2,3-b]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5H-chromeno[2,3-b]pyridin-5-ol?
The IUPAC name of (5S)-5H-chromeno[2,3-b]pyridin-5-ol (CID 51374273) is (5S)-5H-chromeno[2,3-b]pyridin-5-ol.
What is the SMILES notation for (5S)-5H-chromeno[2,3-b]pyridin-5-ol?
The canonical SMILES for (5S)-5H-chromeno[2,3-b]pyridin-5-ol is O[C@H]1c2ccccc2Oc2ncccc21.
What is the InChIKey of (5S)-5H-chromeno[2,3-b]pyridin-5-ol?
The InChIKey is CAOGEKWDLGLKQK-NSHDSACASA-N. The full InChI is InChI=1S/C12H9NO2/c14-11-8-4-1-2-6-10(8)15-12-9(11)5-3-7-13-12/h1-7,11,14H/t11-/m0/s1.
What are the key properties of (5S)-5H-chromeno[2,3-b]pyridin-5-ol?
(5S)-5H-chromeno[2,3-b]pyridin-5-ol has a molecular weight of 199.21 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5H-chromeno[2,3-b]pyridin-5-ol is sourced from PubChem (CID 51374273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).