About 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one
5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one (PubChem CID 51375276) has the molecular formula C23H20N2O3S
and a molecular weight of 404.49 g/mol. Its IUPAC name is 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one.
Molecular Properties
| Compound Name | 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one |
| PubChem CID | 51375276 |
| Molecular Formula | C23H20N2O3S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one |
| SMILES | O=c1c(CC[S@](=O)c2ccccc2)c(O)n(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C23H20N2O3S/c26-22-21(16-17-29(28)20-14-8-3-9-15-20)23(27)25(19-12-6-2-7-13-19)24(22)18-10-4-1-5-11-18/h1-15,26H,16-17H2/t29-/m0/s1 |
| InChIKey | AUMHDRMJJNZTPB-LJAQVGFWSA-N |
| XLogP | 3.68 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one?
The IUPAC name of 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one (CID 51375276) is 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one.
What is the SMILES notation for 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one?
The canonical SMILES for 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one is O=c1c(CC[S@](=O)c2ccccc2)c(O)n(-c2ccccc2)n1-c1ccccc1.
What is the InChIKey of 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one?
The InChIKey is AUMHDRMJJNZTPB-LJAQVGFWSA-N. The full InChI is InChI=1S/C23H20N2O3S/c26-22-21(16-17-29(28)20-14-8-3-9-15-20)23(27)25(19-12-6-2-7-13-19)24(22)18-10-4-1-5-11-18/h1-15,26H,16-17H2/t29-/m0/s1.
What are the key properties of 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one?
5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one has a molecular weight of 404.49 g/mol, XLogP of 3.68, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-1,2-diphenyl-4-[2-[(S)-phenylsulfinyl]ethyl]pyrazol-3-one is sourced from PubChem (CID 51375276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).