C32H41FN4O6S — CID 513778
3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-fluorophenyl)methyl]urea (PubChem CID 513778) has the molecular formula C32H41FN4O6S and a molecular weight of 628.77 g/mol. Its IUPAC name is 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-fluorophenyl)methyl]urea.
| Compound Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 513778 |
| Molecular Formula | C32H41FN4O6S |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-fluorophenyl)methyl]urea |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)N(Cc1ccc(F)cc1)Cc1ccc2c(c1)OCO2)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C32H41FN4O6S/c1-23(2)18-37(44(40,41)29-13-11-27(34)12-14-29)28(21-38)5-3-4-16-35-32(39)36(19-24-6-9-26(33)10-7-24)20-25-8-15-30-31(17-25)43-22-42-30/h6-15,17,23,28,38H,3-5,16,18-22,34H2,1-2H3,(H,35,39)/t28-/m0/s1 |
| InChIKey | RTLPHHSSFSSEFA-NDEPHWFRSA-N |
| XLogP | 4.73 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|