C18H14N4O5 — CID 51378008
[(3aS,4R,7S,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 5-methyl-2-phenyltriazole-4-carboxylate (PubChem CID 51378008) has the molecular formula C18H14N4O5 and a molecular weight of 366.33 g/mol. Its IUPAC name is [(3aS,4R,7S,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 5-methyl-2-phenyltriazole-4-carboxylate.
| Compound Name | [(3aS,4R,7S,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 5-methyl-2-phenyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 51378008 |
| Molecular Formula | C18H14N4O5 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [(3aS,4R,7S,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl] 5-methyl-2-phenyltriazole-4-carboxylate |
| SMILES | Cc1nn(-c2ccccc2)nc1C(=O)ON1C(=O)[C@@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C18H14N4O5/c1-9-15(20-22(19-9)10-5-3-2-4-6-10)18(25)27-21-16(23)13-11-7-8-12(26-11)14(13)17(21)24/h2-8,11-14H,1H3/t11-,12+,13-,14+ |
| InChIKey | OTWOBXFZDAYTKV-KPWCQOOUSA-N |
| XLogP | 0.59 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|