C30H40N4O6S2 — CID 513786
3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-(thiophen-2-ylmethyl)urea (PubChem CID 513786) has the molecular formula C30H40N4O6S2 and a molecular weight of 616.81 g/mol. Its IUPAC name is 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-(thiophen-2-ylmethyl)urea.
| Compound Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 513786 |
| Molecular Formula | C30H40N4O6S2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-(thiophen-2-ylmethyl)urea |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)N(Cc1ccc2c(c1)OCO2)Cc1cccs1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C30H40N4O6S2/c1-22(2)17-34(42(37,38)27-11-9-24(31)10-12-27)25(20-35)6-3-4-14-32-30(36)33(19-26-7-5-15-41-26)18-23-8-13-28-29(16-23)40-21-39-28/h5,7-13,15-16,22,25,35H,3-4,6,14,17-21,31H2,1-2H3,(H,32,36)/t25-/m0/s1 |
| InChIKey | MSBYYCSXZCEAQC-VWLOTQADSA-N |
| XLogP | 4.65 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|