C32H42N4O6S — CID 513793
3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-benzylurea (PubChem CID 513793) has the molecular formula C32H42N4O6S and a molecular weight of 610.78 g/mol. Its IUPAC name is 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-benzylurea.
| Compound Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-benzylurea |
|---|---|
| PubChem CID | 513793 |
| Molecular Formula | C32H42N4O6S |
| Molecular Weight | 610.78 g/mol |
| Exact Mass | 610.28 |
| IUPAC Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-benzylurea |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)N(Cc1ccccc1)Cc1ccc2c(c1)OCO2)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C32H42N4O6S/c1-24(2)19-36(43(39,40)29-14-12-27(33)13-15-29)28(22-37)10-6-7-17-34-32(38)35(20-25-8-4-3-5-9-25)21-26-11-16-30-31(18-26)42-23-41-30/h3-5,8-9,11-16,18,24,28,37H,6-7,10,17,19-23,33H2,1-2H3,(H,34,38)/t28-/m0/s1 |
| InChIKey | GQOPCFAFZYELPN-NDEPHWFRSA-N |
| XLogP | 4.59 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.78 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|