C33H44N4O7S — CID 513794
3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]urea (PubChem CID 513794) has the molecular formula C33H44N4O7S and a molecular weight of 640.80 g/mol. Its IUPAC name is 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 513794 |
| Molecular Formula | C33H44N4O7S |
| Molecular Weight | 640.80 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CN(Cc2ccc3c(c2)OCO3)C(=O)NCCCC[C@@H](CO)N(CC(C)C)S(=O)(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C33H44N4O7S/c1-24(2)19-37(45(40,41)30-14-10-27(34)11-15-30)28(22-38)6-4-5-17-35-33(39)36(20-25-7-12-29(42-3)13-8-25)21-26-9-16-31-32(18-26)44-23-43-31/h7-16,18,24,28,38H,4-6,17,19-23,34H2,1-3H3,(H,35,39)/t28-/m0/s1 |
| InChIKey | YLZXTYZKINQZLV-NDEPHWFRSA-N |
| XLogP | 4.60 |
| TPSA | 143.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.80 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|