C32H44N4O4S — CID 513797
3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1,1-dibenzylurea (PubChem CID 513797) has the molecular formula C32H44N4O4S and a molecular weight of 580.80 g/mol. Its IUPAC name is 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1,1-dibenzylurea.
| Compound Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1,1-dibenzylurea |
|---|---|
| PubChem CID | 513797 |
| Molecular Formula | C32H44N4O4S |
| Molecular Weight | 580.80 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1,1-dibenzylurea |
| SMILES | CC(C)CCN([C@H](CO)CCCCNC(=O)N(Cc1ccccc1)Cc1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C32H44N4O4S/c1-26(2)20-22-36(41(39,40)31-18-16-29(33)17-19-31)30(25-37)15-9-10-21-34-32(38)35(23-27-11-5-3-6-12-27)24-28-13-7-4-8-14-28/h3-8,11-14,16-19,26,30,37H,9-10,15,20-25,33H2,1-2H3,(H,34,38)/t30-/m0/s1 |
| InChIKey | AYQCDKQNMGJQDP-PMERELPUSA-N |
| XLogP | 5.25 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.80 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|