C33H43N5O8S — CID 513800
3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-nitrophenyl)methyl]urea (PubChem CID 513800) has the molecular formula C33H43N5O8S and a molecular weight of 669.80 g/mol. Its IUPAC name is 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-nitrophenyl)methyl]urea.
| Compound Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-nitrophenyl)methyl]urea |
|---|---|
| PubChem CID | 513800 |
| Molecular Formula | C33H43N5O8S |
| Molecular Weight | 669.80 g/mol |
| Exact Mass | 669.28 |
| IUPAC Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-nitrophenyl)methyl]urea |
| SMILES | CC(C)CCN([C@H](CO)CCCCNC(=O)N(Cc1ccc([N+](=O)[O-])cc1)Cc1ccc2c(c1)OCO2)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C33H43N5O8S/c1-24(2)16-18-37(47(43,44)30-13-9-27(34)10-14-30)29(22-39)5-3-4-17-35-33(40)36(20-25-6-11-28(12-7-25)38(41)42)21-26-8-15-31-32(19-26)46-23-45-31/h6-15,19,24,29,39H,3-5,16-18,20-23,34H2,1-2H3,(H,35,40)/t29-/m0/s1 |
| InChIKey | FKDHOENKKMWEMD-LJAQVGFWSA-N |
| XLogP | 4.89 |
| TPSA | 177.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.80 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|