About 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid
4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid (PubChem CID 51380116) has the molecular formula C19H11Cl2N3O3
and a molecular weight of 400.22 g/mol. Its IUPAC name is 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid |
| PubChem CID | 51380116 |
| Molecular Formula | C19H11Cl2N3O3 |
| Molecular Weight | 400.22 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid |
| SMILES | N#Cc1c(-c2c(Cl)cccc2Cl)noc1C/C=N/c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H11Cl2N3O3/c20-14-2-1-3-15(21)17(14)18-13(10-22)16(27-24-18)8-9-23-12-6-4-11(5-7-12)19(25)26/h1-7,9H,8H2,(H,25,26)/b23-9+ |
| InChIKey | HMZNIOHEJWJLNX-NUGSKGIGSA-N |
| XLogP | 5.16 |
| TPSA | 99.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.22 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid?
The IUPAC name of 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid (CID 51380116) is 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid.
What is the SMILES notation for 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid?
The canonical SMILES for 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid is N#Cc1c(-c2c(Cl)cccc2Cl)noc1C/C=N/c1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid?
The InChIKey is HMZNIOHEJWJLNX-NUGSKGIGSA-N. The full InChI is InChI=1S/C19H11Cl2N3O3/c20-14-2-1-3-15(21)17(14)18-13(10-22)16(27-24-18)8-9-23-12-6-4-11(5-7-12)19(25)26/h1-7,9H,8H2,(H,25,26)/b23-9+.
What are the key properties of 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid?
4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid has a molecular weight of 400.22 g/mol, XLogP of 5.16, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-cyano-3-(2,6-dichlorophenyl)-1,2-oxazol-5-yl]ethylideneamino]benzoic acid is sourced from PubChem (CID 51380116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).