About (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione
(5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione (PubChem CID 51380896) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione.
Molecular Properties
| Compound Name | (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione |
| PubChem CID | 51380896 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione |
| SMILES | CC[C@]1(C)OC(=O)N(C)C1=O |
| InChI | InChI=1S/C7H11NO3/c1-4-7(2)5(9)8(3)6(10)11-7/h4H2,1-3H3/t7-/m0/s1 |
| InChIKey | VQASKUSHBVDKGU-ZETCQYMHSA-N |
| XLogP | 0.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione?
The IUPAC name of (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione (CID 51380896) is (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione?
The canonical SMILES for (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione is CC[C@]1(C)OC(=O)N(C)C1=O.
What is the InChIKey of (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione?
The InChIKey is VQASKUSHBVDKGU-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H11NO3/c1-4-7(2)5(9)8(3)6(10)11-7/h4H2,1-3H3/t7-/m0/s1.
What are the key properties of (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione?
(5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione has a molecular weight of 157.17 g/mol, XLogP of 0.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 51380896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).