C10H13N5 — CID 51381031
6-[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1,3,5-triazine-2,4-diamine (PubChem CID 51381031) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 6-[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 51381031 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 6-[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc([C@@H]2C[C@H]3C=C[C@@H]2C3)n1 |
| InChI | InChI=1S/C10H13N5/c11-9-13-8(14-10(12)15-9)7-4-5-1-2-6(7)3-5/h1-2,5-7H,3-4H2,(H4,11,12,13,14,15)/t5-,6+,7+/m0/s1 |
| InChIKey | YQWDFJBNDRSRRN-RRKCRQDMSA-N |
| XLogP | 0.72 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|