C33H43FN4O6S — CID 513813
3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-fluorophenyl)methyl]urea (PubChem CID 513813) has the molecular formula C33H43FN4O6S and a molecular weight of 642.79 g/mol. Its IUPAC name is 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-fluorophenyl)methyl]urea.
| Compound Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-fluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 513813 |
| Molecular Formula | C33H43FN4O6S |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | 3-[(5S)-5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(4-fluorophenyl)methyl]urea |
| SMILES | CC(C)CCN([C@H](CO)CCCCNC(=O)N(Cc1ccc(F)cc1)Cc1ccc2c(c1)OCO2)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C33H43FN4O6S/c1-24(2)16-18-38(45(41,42)30-13-11-28(35)12-14-30)29(22-39)5-3-4-17-36-33(40)37(20-25-6-9-27(34)10-7-25)21-26-8-15-31-32(19-26)44-23-43-31/h6-15,19,24,29,39H,3-5,16-18,20-23,35H2,1-2H3,(H,36,40)/t29-/m0/s1 |
| InChIKey | WMJABJAWSXWQQI-LJAQVGFWSA-N |
| XLogP | 5.12 |
| TPSA | 134.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|