About [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate
[4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate (PubChem CID 513847) has the molecular formula C18H17N5O5
and a molecular weight of 383.36 g/mol. Its IUPAC name is [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate.
Molecular Properties
| Compound Name | [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate |
| PubChem CID | 513847 |
| Molecular Formula | C18H17N5O5 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2cn3c(=O)c4ncn(COCCO)c4nc3[nH]2)cc1 |
| InChI | InChI=1S/C18H17N5O5/c1-11(25)28-13-4-2-12(3-5-13)14-8-23-17(26)15-16(21-18(23)20-14)22(9-19-15)10-27-7-6-24/h2-5,8-9,24H,6-7,10H2,1H3,(H,20,21) |
| InChIKey | XOOUQFQOYUZXSE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate?
The IUPAC name of [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate (CID 513847) is [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate.
What is the SMILES notation for [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate?
The canonical SMILES for [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate is CC(=O)Oc1ccc(-c2cn3c(=O)c4ncn(COCCO)c4nc3[nH]2)cc1.
What is the InChIKey of [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate?
The InChIKey is XOOUQFQOYUZXSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N5O5/c1-11(25)28-13-4-2-12(3-5-13)14-8-23-17(26)15-16(21-18(23)20-14)22(9-19-15)10-27-7-6-24/h2-5,8-9,24H,6-7,10H2,1H3,(H,20,21).
What are the key properties of [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate?
[4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate has a molecular weight of 383.36 g/mol, XLogP of 0.93, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(2-hydroxyethoxymethyl)-9-oxo-5H-imidazo[1,2-a]purin-6-yl]phenyl] acetate is sourced from PubChem (CID 513847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).