About 12-methyltridecanoate
12-methyltridecanoate (PubChem CID 51387508) has the molecular formula C14H27O2-
and a molecular weight of 227.37 g/mol. Its IUPAC name is 12-methyltridecanoate.
Molecular Properties
| Compound Name | 12-methyltridecanoate |
| PubChem CID | 51387508 |
| Molecular Formula | C14H27O2- |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 12-methyltridecanoate |
| SMILES | CC(C)CCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C14H28O2/c1-13(2)11-9-7-5-3-4-6-8-10-12-14(15)16/h13H,3-12H2,1-2H3,(H,15,16)/p-1 |
| InChIKey | YYVJAABUJYRQJO-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 12-methyltridecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-methyltridecanoate?
The IUPAC name of 12-methyltridecanoate (CID 51387508) is 12-methyltridecanoate.
What is the SMILES notation for 12-methyltridecanoate?
The canonical SMILES for 12-methyltridecanoate is CC(C)CCCCCCCCCCC(=O)[O-].
What is the InChIKey of 12-methyltridecanoate?
The InChIKey is YYVJAABUJYRQJO-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H28O2/c1-13(2)11-9-7-5-3-4-6-8-10-12-14(15)16/h13H,3-12H2,1-2H3,(H,15,16)/p-1.
What are the key properties of 12-methyltridecanoate?
12-methyltridecanoate has a molecular weight of 227.37 g/mol, XLogP of 3.29, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-methyltridecanoate is sourced from PubChem (CID 51387508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).