C17H19N7O2S — CID 51388891
(Z)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]-1-(4-methylphenyl)methanimine (PubChem CID 51388891) has the molecular formula C17H19N7O2S and a molecular weight of 385.45 g/mol. Its IUPAC name is (Z)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]-1-(4-methylphenyl)methanimine.
| Compound Name | (Z)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]-1-(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 51388891 |
| Molecular Formula | C17H19N7O2S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (Z)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]-1-(4-methylphenyl)methanimine |
| SMILES | Cc1ccc(/C=N\n2c(C)nnc2SCn2nc(C)c([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C17H19N7O2S/c1-11-5-7-15(8-6-11)9-18-23-14(4)19-20-17(23)27-10-22-13(3)16(24(25)26)12(2)21-22/h5-9H,10H2,1-4H3/b18-9- |
| InChIKey | QRXHZSZKBYIESF-NVMNQCDNSA-N |
| XLogP | 3.25 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|