C23H22IN3O2 — CID 51389146
(2S)-2-[4-(dimethylamino)phenyl]-6-iodo-3-(4-methoxyphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 51389146) has the molecular formula C23H22IN3O2 and a molecular weight of 499.35 g/mol. Its IUPAC name is (2S)-2-[4-(dimethylamino)phenyl]-6-iodo-3-(4-methoxyphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-2-[4-(dimethylamino)phenyl]-6-iodo-3-(4-methoxyphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 51389146 |
| Molecular Formula | C23H22IN3O2 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | (2S)-2-[4-(dimethylamino)phenyl]-6-iodo-3-(4-methoxyphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | COc1ccc(N2C(=O)c3cc(I)ccc3N[C@@H]2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H22IN3O2/c1-26(2)17-7-4-15(5-8-17)22-25-21-13-6-16(24)14-20(21)23(28)27(22)18-9-11-19(29-3)12-10-18/h4-14,22,25H,1-3H3/t22-/m0/s1 |
| InChIKey | JYOYNTVJVLPGSZ-QFIPXVFZSA-N |
| XLogP | 5.14 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|