C24H25ClN4O2 — CID 51389613
(4R,4aS)-2-amino-4-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 51389613) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is (4R,4aS)-2-amino-4-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | (4R,4aS)-2-amino-4-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 51389613 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (4R,4aS)-2-amino-4-(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)-4a,5,6,7-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | CCOc1cc([C@H]2[C@@H]3CCCC=C3C(C#N)=C(N)C2(C#N)C#N)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C24H25ClN4O2/c1-4-30-20-10-15(9-19(25)22(20)31-14(2)3)21-17-8-6-5-7-16(17)18(11-26)23(29)24(21,12-27)13-28/h7,9-10,14,17,21H,4-6,8,29H2,1-3H3/t17-,21+/m1/s1 |
| InChIKey | PYEYWFQCCJAYAZ-UTKZUKDTSA-N |
| XLogP | 5.12 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|