C12H17ClN4O — CID 51389669
[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone (PubChem CID 51389669) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone.
| Compound Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 51389669 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(4-chloro-1-methylpyrazol-5-yl)methanone |
| SMILES | Cn1ncc(Cl)c1C(=O)N1CCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C12H17ClN4O/c1-15-11(10(13)7-14-15)12(18)17-6-5-16-4-2-3-9(16)8-17/h7,9H,2-6,8H2,1H3/t9-/m0/s1 |
| InChIKey | IXWHZPUVYZZZKF-VIFPVBQESA-N |
| XLogP | 0.99 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |