C14H18BrF3N4O — CID 51389919
1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone (PubChem CID 51389919) has the molecular formula C14H18BrF3N4O and a molecular weight of 395.22 g/mol. Its IUPAC name is 1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone.
| Compound Name | 1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 51389919 |
| Molecular Formula | C14H18BrF3N4O |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 1-[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]ethanone |
| SMILES | Cc1c(Br)c(C(F)(F)F)nn1CC(=O)N1CCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C14H18BrF3N4O/c1-9-12(15)13(14(16,17)18)19-22(9)8-11(23)21-6-5-20-4-2-3-10(20)7-21/h10H,2-8H2,1H3/t10-/m0/s1 |
| InChIKey | YWHUAGBHVJOCRW-JTQLQIEISA-N |
| XLogP | 2.28 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |