C21H20F3N5O — CID 51389973
[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[7-(difluoromethyl)-5-(4-fluorophenyl)pyrazolo[1,5-a]pyrimidin-3-yl]methanone (PubChem CID 51389973) has the molecular formula C21H20F3N5O and a molecular weight of 415.42 g/mol. Its IUPAC name is [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[7-(difluoromethyl)-5-(4-fluorophenyl)pyrazolo[1,5-a]pyrimidin-3-yl]methanone.
| Compound Name | [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[7-(difluoromethyl)-5-(4-fluorophenyl)pyrazolo[1,5-a]pyrimidin-3-yl]methanone |
|---|---|
| PubChem CID | 51389973 |
| Molecular Formula | C21H20F3N5O |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | [(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-[7-(difluoromethyl)-5-(4-fluorophenyl)pyrazolo[1,5-a]pyrimidin-3-yl]methanone |
| SMILES | O=C(c1cnn2c(C(F)F)cc(-c3ccc(F)cc3)nc12)N1CCN2CCC[C@@H]2C1 |
| InChI | InChI=1S/C21H20F3N5O/c22-14-5-3-13(4-6-14)17-10-18(19(23)24)29-20(26-17)16(11-25-29)21(30)28-9-8-27-7-1-2-15(27)12-28/h3-6,10-11,15,19H,1-2,7-9,12H2/t15-/m1/s1 |
| InChIKey | RLXRTJOGRSMXIS-OAHLLOKOSA-N |
| XLogP | 3.39 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |