C20H19N3O2 — CID 513900
1-(4-methylidenecyclohexyl)-2-pyridin-2-ylbenzimidazole-5-carboxylic acid (PubChem CID 513900) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is 1-(4-methylidenecyclohexyl)-2-pyridin-2-ylbenzimidazole-5-carboxylic acid.
| Compound Name | 1-(4-methylidenecyclohexyl)-2-pyridin-2-ylbenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 513900 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-(4-methylidenecyclohexyl)-2-pyridin-2-ylbenzimidazole-5-carboxylic acid |
| SMILES | C=C1CCC(n2c(-c3ccccn3)nc3cc(C(=O)O)ccc32)CC1 |
| InChI | InChI=1S/C20H19N3O2/c1-13-5-8-15(9-6-13)23-18-10-7-14(20(24)25)12-17(18)22-19(23)16-4-2-3-11-21-16/h2-4,7,10-12,15H,1,5-6,8-9H2,(H,24,25) |
| InChIKey | RLCZXWGHKUAPAI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|