C18H13F6NO4 — CID 51391658
(3S)-3-[3,5-bis(2,2,2-trifluoroethoxy)anilino]-3H-2-benzofuran-1-one (PubChem CID 51391658) has the molecular formula C18H13F6NO4 and a molecular weight of 421.29 g/mol. Its IUPAC name is (3S)-3-[3,5-bis(2,2,2-trifluoroethoxy)anilino]-3H-2-benzofuran-1-one.
| Compound Name | (3S)-3-[3,5-bis(2,2,2-trifluoroethoxy)anilino]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 51391658 |
| Molecular Formula | C18H13F6NO4 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | (3S)-3-[3,5-bis(2,2,2-trifluoroethoxy)anilino]-3H-2-benzofuran-1-one |
| SMILES | O=C1O[C@H](Nc2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C18H13F6NO4/c19-17(20,21)8-27-11-5-10(6-12(7-11)28-9-18(22,23)24)25-15-13-3-1-2-4-14(13)16(26)29-15/h1-7,15,25H,8-9H2/t15-/m0/s1 |
| InChIKey | OIKOJRJKWBKXCS-HNNXBMFYSA-N |
| XLogP | 4.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |