C19H17ClN4S — CID 51392270
4-[(1R,2R)-2-(4-chlorophenyl)cyclopropyl]-12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 51392270) has the molecular formula C19H17ClN4S and a molecular weight of 368.89 g/mol. Its IUPAC name is 4-[(1R,2R)-2-(4-chlorophenyl)cyclopropyl]-12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-[(1R,2R)-2-(4-chlorophenyl)cyclopropyl]-12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 51392270 |
| Molecular Formula | C19H17ClN4S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 4-[(1R,2R)-2-(4-chlorophenyl)cyclopropyl]-12-ethyl-11-methyl-10-thia-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCc1c(C)sc2ncn3nc([C@@H]4C[C@H]4c4ccc(Cl)cc4)nc3c12 |
| InChI | InChI=1S/C19H17ClN4S/c1-3-13-10(2)25-19-16(13)18-22-17(23-24(18)9-21-19)15-8-14(15)11-4-6-12(20)7-5-11/h4-7,9,14-15H,3,8H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | WBCZDSQWXDWWLV-LSDHHAIUSA-N |
| XLogP | 5.13 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |