C19H17Cl2N2OPS — CID 51394550
2,3-dichloro-N-[phenyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline (PubChem CID 51394550) has the molecular formula C19H17Cl2N2OPS and a molecular weight of 423.31 g/mol. Its IUPAC name is 2,3-dichloro-N-[phenyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline.
| Compound Name | 2,3-dichloro-N-[phenyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline |
|---|---|
| PubChem CID | 51394550 |
| Molecular Formula | C19H17Cl2N2OPS |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 2,3-dichloro-N-[phenyl(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)phosphoryl]aniline |
| SMILES | O=[P@](Nc1cccc(Cl)c1Cl)(c1ccccc1)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C19H17Cl2N2OPS/c20-14-9-6-11-16(18(14)21)23-25(24,13-7-2-1-3-8-13)19-22-15-10-4-5-12-17(15)26-19/h1-3,6-9,11H,4-5,10,12H2,(H,23,24)/t25-/m1/s1 |
| InChIKey | VQVPEUAQZBQEJR-RUZDIDTESA-N |
| XLogP | 5.67 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|