C35H52N2O4 — CID 5139684
1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperidine-4-carboxamide (PubChem CID 5139684) has the molecular formula C35H52N2O4 and a molecular weight of 564.81 g/mol. Its IUPAC name is 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 5139684 |
| Molecular Formula | C35H52N2O4 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.39 |
| IUPAC Name | 1-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperidine-4-carboxamide |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C35H52N2O4/c1-31-13-8-25(38)20-33(31)16-17-35(26(21-33)29(39)23-6-4-3-5-7-23)27(31)9-14-32(2)28(35)10-15-34(32,41)22-37-18-11-24(12-19-37)30(36)40/h16-17,21,23-25,27-28,38,41H,3-15,18-20,22H2,1-2H3,(H2,36,40) |
| InChIKey | YGFHVDYQNXOVHN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|