C32H50O2 — CID 51398192
[(3S,9R,10R,13R,14R,17S)-17-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-4,4,10,13-tetramethyl-1,2,3,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 51398192) has the molecular formula C32H50O2 and a molecular weight of 466.75 g/mol. Its IUPAC name is [(3S,9R,10R,13R,14R,17S)-17-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-4,4,10,13-tetramethyl-1,2,3,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,9R,10R,13R,14R,17S)-17-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-4,4,10,13-tetramethyl-1,2,3,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 51398192 |
| Molecular Formula | C32H50O2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | [(3S,9R,10R,13R,14R,17S)-17-[(E,2R,5S)-5,6-dimethylhept-3-en-2-yl]-4,4,10,13-tetramethyl-1,2,3,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC=C3[C@H]2CC[C@@]2(C)[C@H]3CC[C@H]2[C@H](C)/C=C/[C@@H](C)C(C)C)C1(C)C |
| InChI | InChI=1S/C32H50O2/c1-20(2)21(3)10-11-22(4)25-13-14-26-24-12-15-28-30(6,7)29(34-23(5)33)17-19-32(28,9)27(24)16-18-31(25,26)8/h10-12,15,20-22,25-27,29H,13-14,16-19H2,1-9H3/b11-10+/t21-,22-,25+,26+,27-,29+,31-,32-/m1/s1 |
| InChIKey | NZNSOPHQRHNYSM-VOBQACLMSA-N |
| XLogP | 8.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|