C35H46N4O5S — CID 513997
N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]cyclopropanecarboxamide (PubChem CID 513997) has the molecular formula C35H46N4O5S and a molecular weight of 634.84 g/mol. Its IUPAC name is N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 513997 |
| Molecular Formula | C35H46N4O5S |
| Molecular Weight | 634.84 g/mol |
| Exact Mass | 634.32 |
| IUPAC Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]cyclopropanecarboxamide |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)[C@@H](NC(=O)C1CC1)C(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C35H46N4O5S/c1-25(2)23-39(45(43,44)31-20-18-29(36)19-21-31)30(24-40)15-9-10-22-37-35(42)33(38-34(41)28-16-17-28)32(26-11-5-3-6-12-26)27-13-7-4-8-14-27/h3-8,11-14,18-21,25,28,30,32-33,40H,9-10,15-17,22-24,36H2,1-2H3,(H,37,42)(H,38,41)/t30-,33-/m0/s1 |
| InChIKey | IDZLZILNJRBKDA-DITALETJSA-N |
| XLogP | 4.29 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.84 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|