C22H27N2OS+ — CID 5139971
1-(4-tert-butylphenyl)-2-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol (PubChem CID 5139971) has the molecular formula C22H27N2OS+ and a molecular weight of 367.54 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol.
| Compound Name | 1-(4-tert-butylphenyl)-2-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
|---|---|
| PubChem CID | 5139971 |
| Molecular Formula | C22H27N2OS+ |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-phenyl-3,5,6,7-tetrahydroimidazo[2,1-b][1,3]thiazin-4-ium-2-ol |
| SMILES | CC(C)(C)c1ccc(N2C3=[N+](CCCS3)CC2(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H27N2OS/c1-21(2,3)17-10-12-19(13-11-17)24-20-23(14-7-15-26-20)16-22(24,25)18-8-5-4-6-9-18/h4-6,8-13,25H,7,14-16H2,1-3H3/q+1 |
| InChIKey | ZKVZFXKKOZLDTN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|