C34H45FN4O6S — CID 514007
N-[(2S)-1-[[(5S)-5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]oxolane-3-carboxamide (PubChem CID 514007) has the molecular formula C34H45FN4O6S and a molecular weight of 656.82 g/mol. Its IUPAC name is N-[(2S)-1-[[(5S)-5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]oxolane-3-carboxamide.
| Compound Name | N-[(2S)-1-[[(5S)-5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 514007 |
| Molecular Formula | C34H45FN4O6S |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | N-[(2S)-1-[[(5S)-5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-naphthalen-2-yl-1-oxopropan-2-yl]oxolane-3-carboxamide |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)[C@H](Cc1ccc2ccccc2c1)NC(=O)C1CCOC1)S(=O)(=O)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C34H45FN4O6S/c1-23(2)20-39(46(43,44)29-12-13-30(35)31(36)19-29)28(21-40)9-5-6-15-37-34(42)32(38-33(41)27-14-16-45-22-27)18-24-10-11-25-7-3-4-8-26(25)17-24/h3-4,7-8,10-13,17,19,23,27-28,32,40H,5-6,9,14-16,18,20-22,36H2,1-2H3,(H,37,42)(H,38,41)/t27?,28-,32-/m0/s1 |
| InChIKey | JKDYXILHQZJPBA-HXXDBUBKSA-N |
| XLogP | 3.62 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|