C36H45N5O5S — CID 514018
N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]-1H-pyrrole-2-carboxamide (PubChem CID 514018) has the molecular formula C36H45N5O5S and a molecular weight of 659.85 g/mol. Its IUPAC name is N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 514018 |
| Molecular Formula | C36H45N5O5S |
| Molecular Weight | 659.85 g/mol |
| Exact Mass | 659.31 |
| IUPAC Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]-1H-pyrrole-2-carboxamide |
| SMILES | CC(C)CN([C@H](CO)CCCCNC(=O)[C@@H](NC(=O)c1ccc[nH]1)C(c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C36H45N5O5S/c1-26(2)24-41(47(45,46)31-20-18-29(37)19-21-31)30(25-42)16-9-10-22-39-36(44)34(40-35(43)32-17-11-23-38-32)33(27-12-5-3-6-13-27)28-14-7-4-8-15-28/h3-8,11-15,17-21,23,26,30,33-34,38,42H,9-10,16,22,24-25,37H2,1-2H3,(H,39,44)(H,40,43)/t30-,34-/m0/s1 |
| InChIKey | SMDTWGSHOCRZCU-NHZFLZHXSA-N |
| XLogP | 4.52 |
| TPSA | 157.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|