C16H15F3N2O5 — CID 51402941
[(2E,6R)-2-(2-methoxy-2-oxoethylidene)-3-oxo-1,4-diazepan-6-yl] 4-(trifluoromethyl)benzoate (PubChem CID 51402941) has the molecular formula C16H15F3N2O5 and a molecular weight of 372.30 g/mol. Its IUPAC name is [(2E,6R)-2-(2-methoxy-2-oxoethylidene)-3-oxo-1,4-diazepan-6-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(2E,6R)-2-(2-methoxy-2-oxoethylidene)-3-oxo-1,4-diazepan-6-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 51402941 |
| Molecular Formula | C16H15F3N2O5 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [(2E,6R)-2-(2-methoxy-2-oxoethylidene)-3-oxo-1,4-diazepan-6-yl] 4-(trifluoromethyl)benzoate |
| SMILES | COC(=O)/C=C1/NC[C@@H](OC(=O)c2ccc(C(F)(F)F)cc2)CNC1=O |
| InChI | InChI=1S/C16H15F3N2O5/c1-25-13(22)6-12-14(23)21-8-11(7-20-12)26-15(24)9-2-4-10(5-3-9)16(17,18)19/h2-6,11,20H,7-8H2,1H3,(H,21,23)/b12-6+/t11-/m1/s1 |
| InChIKey | OXTVWKCGQNBLHD-GGQLTLKSSA-N |
| XLogP | 1.01 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|