C38H47N5O5S — CID 514031
N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]-2-methylpyridine-3-carboxamide (PubChem CID 514031) has the molecular formula C38H47N5O5S and a molecular weight of 685.89 g/mol. Its IUPAC name is N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]-2-methylpyridine-3-carboxamide.
| Compound Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 514031 |
| Molecular Formula | C38H47N5O5S |
| Molecular Weight | 685.89 g/mol |
| Exact Mass | 685.33 |
| IUPAC Name | N-[(2S)-1-[[(5S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-1-oxo-3,3-diphenylpropan-2-yl]-2-methylpyridine-3-carboxamide |
| SMILES | Cc1ncccc1C(=O)N[C@H](C(=O)NCCCC[C@@H](CO)N(CC(C)C)S(=O)(=O)c1ccc(N)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H47N5O5S/c1-27(2)25-43(49(47,48)33-21-19-31(39)20-22-33)32(26-44)17-10-11-23-41-38(46)36(42-37(45)34-18-12-24-40-28(34)3)35(29-13-6-4-7-14-29)30-15-8-5-9-16-30/h4-9,12-16,18-22,24,27,32,35-36,44H,10-11,17,23,25-26,39H2,1-3H3,(H,41,46)(H,42,45)/t32-,36-/m0/s1 |
| InChIKey | SXDLZTIFOPNTPB-IKYOIFQTSA-N |
| XLogP | 4.90 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.89 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|