About (3R)-3-butoxythiolane 1,1-dioxide
(3R)-3-butoxythiolane 1,1-dioxide (PubChem CID 51404449) has the molecular formula C8H16O3S
and a molecular weight of 192.28 g/mol. Its IUPAC name is (3R)-3-butoxythiolane 1,1-dioxide.
Molecular Properties
| Compound Name | (3R)-3-butoxythiolane 1,1-dioxide |
| PubChem CID | 51404449 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (3R)-3-butoxythiolane 1,1-dioxide |
| SMILES | CCCCO[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H16O3S/c1-2-3-5-11-8-4-6-12(9,10)7-8/h8H,2-7H2,1H3/t8-/m1/s1 |
| InChIKey | JCVVQHUBXPKCPC-MRVPVSSYSA-N |
| XLogP | 0.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-butoxythiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-butoxythiolane 1,1-dioxide?
The IUPAC name of (3R)-3-butoxythiolane 1,1-dioxide (CID 51404449) is (3R)-3-butoxythiolane 1,1-dioxide.
What is the SMILES notation for (3R)-3-butoxythiolane 1,1-dioxide?
The canonical SMILES for (3R)-3-butoxythiolane 1,1-dioxide is CCCCO[C@@H]1CCS(=O)(=O)C1.
What is the InChIKey of (3R)-3-butoxythiolane 1,1-dioxide?
The InChIKey is JCVVQHUBXPKCPC-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H16O3S/c1-2-3-5-11-8-4-6-12(9,10)7-8/h8H,2-7H2,1H3/t8-/m1/s1.
What are the key properties of (3R)-3-butoxythiolane 1,1-dioxide?
(3R)-3-butoxythiolane 1,1-dioxide has a molecular weight of 192.28 g/mol, XLogP of 0.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-butoxythiolane 1,1-dioxide is sourced from PubChem (CID 51404449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).