C15H18N2O5S — CID 51405056
(1S,2R,3S,4R)-3-[[(4,5-dimethylthiophene-3-carbonyl)amino]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 51405056) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is (1S,2R,3S,4R)-3-[[(4,5-dimethylthiophene-3-carbonyl)amino]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | (1S,2R,3S,4R)-3-[[(4,5-dimethylthiophene-3-carbonyl)amino]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 51405056 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (1S,2R,3S,4R)-3-[[(4,5-dimethylthiophene-3-carbonyl)amino]carbamoyl]-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | Cc1scc(C(=O)NNC(=O)[C@H]2[C@@H](C(=O)O)[C@@H]3CC[C@H]2O3)c1C |
| InChI | InChI=1S/C15H18N2O5S/c1-6-7(2)23-5-8(6)13(18)16-17-14(19)11-9-3-4-10(22-9)12(11)15(20)21/h5,9-12H,3-4H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)/t9-,10+,11-,12+/m1/s1 |
| InChIKey | AJXALPZZKVFHDX-KXNHARMFSA-N |
| XLogP | 1.00 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|