About 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea
1-butyl-3-(2,3-dimethylcyclohexyl)thiourea (PubChem CID 5140601) has the molecular formula C13H26N2S
and a molecular weight of 242.43 g/mol. Its IUPAC name is 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea.
Molecular Properties
| Compound Name | 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea |
| PubChem CID | 5140601 |
| Molecular Formula | C13H26N2S |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea |
| SMILES | CCCCNC(=S)NC1CCCC(C)C1C |
| InChI | InChI=1S/C13H26N2S/c1-4-5-9-14-13(16)15-12-8-6-7-10(2)11(12)3/h10-12H,4-9H2,1-3H3,(H2,14,15,16) |
| InChIKey | SXAKMJVAXVVQRR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea?
The IUPAC name of 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea (CID 5140601) is 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea.
What is the SMILES notation for 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea?
The canonical SMILES for 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea is CCCCNC(=S)NC1CCCC(C)C1C.
What is the InChIKey of 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea?
The InChIKey is SXAKMJVAXVVQRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2S/c1-4-5-9-14-13(16)15-12-8-6-7-10(2)11(12)3/h10-12H,4-9H2,1-3H3,(H2,14,15,16).
What are the key properties of 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea?
1-butyl-3-(2,3-dimethylcyclohexyl)thiourea has a molecular weight of 242.43 g/mol, XLogP of 3.08, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-(2,3-dimethylcyclohexyl)thiourea is sourced from PubChem (CID 5140601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).