C28H35NO6 — CID 51407190
3-O-cyclopentyl 6-O-methyl (4R,6S,7R)-2,7-dimethyl-5-oxo-4-(4-propoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 51407190) has the molecular formula C28H35NO6 and a molecular weight of 481.59 g/mol. Its IUPAC name is 3-O-cyclopentyl 6-O-methyl (4R,6S,7R)-2,7-dimethyl-5-oxo-4-(4-propoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-cyclopentyl 6-O-methyl (4R,6S,7R)-2,7-dimethyl-5-oxo-4-(4-propoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 51407190 |
| Molecular Formula | C28H35NO6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 3-O-cyclopentyl 6-O-methyl (4R,6S,7R)-2,7-dimethyl-5-oxo-4-(4-propoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | CCCOc1ccc([C@H]2C(C(=O)OC3CCCC3)=C(C)NC3=C2C(=O)[C@@H](C(=O)OC)[C@H](C)C3)cc1 |
| InChI | InChI=1S/C28H35NO6/c1-5-14-34-19-12-10-18(11-13-19)24-23(28(32)35-20-8-6-7-9-20)17(3)29-21-15-16(2)22(27(31)33-4)26(30)25(21)24/h10-13,16,20,22,24,29H,5-9,14-15H2,1-4H3/t16-,22+,24+/m1/s1 |
| InChIKey | SAZLSIQUBWVOIE-LZGLPUDESA-N |
| XLogP | 4.57 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|