C19H24N2O4 — CID 51409975
1-[(4R,5R,6R)-4-(3,4-dimethoxyphenyl)-6-hydroxy-3,6-dimethyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone (PubChem CID 51409975) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-[(4R,5R,6R)-4-(3,4-dimethoxyphenyl)-6-hydroxy-3,6-dimethyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone.
| Compound Name | 1-[(4R,5R,6R)-4-(3,4-dimethoxyphenyl)-6-hydroxy-3,6-dimethyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone |
|---|---|
| PubChem CID | 51409975 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[(4R,5R,6R)-4-(3,4-dimethoxyphenyl)-6-hydroxy-3,6-dimethyl-2,4,5,7-tetrahydroindazol-5-yl]ethanone |
| SMILES | COc1ccc([C@@H]2c3c(n[nH]c3C)C[C@@](C)(O)[C@@H]2C(C)=O)cc1OC |
| InChI | InChI=1S/C19H24N2O4/c1-10-16-13(21-20-10)9-19(3,23)18(11(2)22)17(16)12-6-7-14(24-4)15(8-12)25-5/h6-8,17-18,23H,9H2,1-5H3,(H,20,21)/t17-,18-,19-/m1/s1 |
| InChIKey | MBIMTDRCHGLGLC-GUDVDZBRSA-N |
| XLogP | 2.38 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |