C16H15N3OS2 — CID 5141028
3,5-dimethyl-N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)benzamide (PubChem CID 5141028) has the molecular formula C16H15N3OS2 and a molecular weight of 329.45 g/mol. Its IUPAC name is 3,5-dimethyl-N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)benzamide.
| Compound Name | 3,5-dimethyl-N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)benzamide |
|---|---|
| PubChem CID | 5141028 |
| Molecular Formula | C16H15N3OS2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3,5-dimethyl-N-(6-methylimidazo[2,1-b][1,3]thiazole-5-carbothioyl)benzamide |
| SMILES | Cc1cc(C)cc(C(=O)NC(=S)c2c(C)nc3sccn23)c1 |
| InChI | InChI=1S/C16H15N3OS2/c1-9-6-10(2)8-12(7-9)14(20)18-15(21)13-11(3)17-16-19(13)4-5-22-16/h4-8H,1-3H3,(H,18,20,21) |
| InChIKey | PVAONIJPFQUPPA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|