About (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate
(2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate (PubChem CID 5141058) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate.
Molecular Properties
| Compound Name | (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate |
| PubChem CID | 5141058 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate |
| SMILES | Cc1ccccc1COC(=O)NNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H18N2O3/c1-13-7-5-6-10-15(13)12-22-17(21)19-18-16(20)11-14-8-3-2-4-9-14/h2-10H,11-12H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | NCLNMGHYJXVGFM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate?
The IUPAC name of (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate (CID 5141058) is (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate.
What is the SMILES notation for (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate?
The canonical SMILES for (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate is Cc1ccccc1COC(=O)NNC(=O)Cc1ccccc1.
What is the InChIKey of (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate?
The InChIKey is NCLNMGHYJXVGFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-13-7-5-6-10-15(13)12-22-17(21)19-18-16(20)11-14-8-3-2-4-9-14/h2-10H,11-12H2,1H3,(H,18,20)(H,19,21).
What are the key properties of (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate?
(2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate has a molecular weight of 298.34 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)methyl N-[(2-phenylacetyl)amino]carbamate is sourced from PubChem (CID 5141058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).