About (3S)-3-pentoxythiolane 1,1-dioxide
(3S)-3-pentoxythiolane 1,1-dioxide (PubChem CID 51411792) has the molecular formula C9H18O3S
and a molecular weight of 206.31 g/mol. Its IUPAC name is (3S)-3-pentoxythiolane 1,1-dioxide.
Molecular Properties
| Compound Name | (3S)-3-pentoxythiolane 1,1-dioxide |
| PubChem CID | 51411792 |
| Molecular Formula | C9H18O3S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | (3S)-3-pentoxythiolane 1,1-dioxide |
| SMILES | CCCCCO[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18O3S/c1-2-3-4-6-12-9-5-7-13(10,11)8-9/h9H,2-8H2,1H3/t9-/m0/s1 |
| InChIKey | MWQYMBACUIWRKS-VIFPVBQESA-N |
| XLogP | 1.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-pentoxythiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-pentoxythiolane 1,1-dioxide?
The IUPAC name of (3S)-3-pentoxythiolane 1,1-dioxide (CID 51411792) is (3S)-3-pentoxythiolane 1,1-dioxide.
What is the SMILES notation for (3S)-3-pentoxythiolane 1,1-dioxide?
The canonical SMILES for (3S)-3-pentoxythiolane 1,1-dioxide is CCCCCO[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of (3S)-3-pentoxythiolane 1,1-dioxide?
The InChIKey is MWQYMBACUIWRKS-VIFPVBQESA-N. The full InChI is InChI=1S/C9H18O3S/c1-2-3-4-6-12-9-5-7-13(10,11)8-9/h9H,2-8H2,1H3/t9-/m0/s1.
What are the key properties of (3S)-3-pentoxythiolane 1,1-dioxide?
(3S)-3-pentoxythiolane 1,1-dioxide has a molecular weight of 206.31 g/mol, XLogP of 1.38, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-pentoxythiolane 1,1-dioxide is sourced from PubChem (CID 51411792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).