About (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol
(2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol (PubChem CID 51411795) has the molecular formula C8H18OS2
and a molecular weight of 194.36 g/mol. Its IUPAC name is (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol.
Molecular Properties
| Compound Name | (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol |
| PubChem CID | 51411795 |
| Molecular Formula | C8H18OS2 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol |
| SMILES | C[C@H](S[C@H](C)[C@@H](C)O)[C@@H](C)S |
| InChI | InChI=1S/C8H18OS2/c1-5(9)7(3)11-8(4)6(2)10/h5-10H,1-4H3/t5-,6-,7-,8+/m1/s1 |
| InChIKey | PHLKBLKTWMSFGF-XUTVFYLZSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol?
The IUPAC name of (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol (CID 51411795) is (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol.
What is the SMILES notation for (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol?
The canonical SMILES for (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol is C[C@H](S[C@H](C)[C@@H](C)O)[C@@H](C)S.
What is the InChIKey of (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol?
The InChIKey is PHLKBLKTWMSFGF-XUTVFYLZSA-N. The full InChI is InChI=1S/C8H18OS2/c1-5(9)7(3)11-8(4)6(2)10/h5-10H,1-4H3/t5-,6-,7-,8+/m1/s1.
What are the key properties of (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol?
(2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol has a molecular weight of 194.36 g/mol, XLogP of 2.20, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-[(2S,3R)-3-sulfanylbutan-2-yl]sulfanylbutan-2-ol is sourced from PubChem (CID 51411795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).