C10H22NO4P — CID 51412260
(2R,4R,5R)-4-dimethoxyphosphoryl-1,2,5-trimethylpiperidin-4-ol (PubChem CID 51412260) has the molecular formula C10H22NO4P and a molecular weight of 251.26 g/mol. Its IUPAC name is (2R,4R,5R)-4-dimethoxyphosphoryl-1,2,5-trimethylpiperidin-4-ol.
| Compound Name | (2R,4R,5R)-4-dimethoxyphosphoryl-1,2,5-trimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 51412260 |
| Molecular Formula | C10H22NO4P |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2R,4R,5R)-4-dimethoxyphosphoryl-1,2,5-trimethylpiperidin-4-ol |
| SMILES | COP(=O)(OC)[C@]1(O)C[C@@H](C)N(C)C[C@H]1C |
| InChI | InChI=1S/C10H22NO4P/c1-8-7-11(3)9(2)6-10(8,12)16(13,14-4)15-5/h8-9,12H,6-7H2,1-5H3/t8-,9-,10-/m1/s1 |
| InChIKey | ANRNCSUBAGMGGV-OPRDCNLKSA-N |
| XLogP | 1.52 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|