C36H28Cl2N4O4 — CID 5141367
4,11-bis(3-chloro-4-methylphenyl)-7,14-diphenyl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 5141367) has the molecular formula C36H28Cl2N4O4 and a molecular weight of 651.55 g/mol. Its IUPAC name is 4,11-bis(3-chloro-4-methylphenyl)-7,14-diphenyl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | 4,11-bis(3-chloro-4-methylphenyl)-7,14-diphenyl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 5141367 |
| Molecular Formula | C36H28Cl2N4O4 |
| Molecular Weight | 651.55 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | 4,11-bis(3-chloro-4-methylphenyl)-7,14-diphenyl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | Cc1ccc(N2C(=O)C3C(C2=O)N2C(c4ccccc4)C4C(=O)N(c5ccc(C)c(Cl)c5)C(=O)C4N2C3c2ccccc2)cc1Cl |
| InChI | InChI=1S/C36H28Cl2N4O4/c1-19-13-15-23(17-25(19)37)39-33(43)27-29(21-9-5-3-6-10-21)42-32-28(30(22-11-7-4-8-12-22)41(42)31(27)35(39)45)34(44)40(36(32)46)24-16-14-20(2)26(38)18-24/h3-18,27-32H,1-2H3 |
| InChIKey | CKCLOYBHERMFJP-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|