About (3S)-N,N,3-trimethylpiperidine-1-sulfonamide
(3S)-N,N,3-trimethylpiperidine-1-sulfonamide (PubChem CID 51415822) has the molecular formula C8H18N2O2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is (3S)-N,N,3-trimethylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | (3S)-N,N,3-trimethylpiperidine-1-sulfonamide |
| PubChem CID | 51415822 |
| Molecular Formula | C8H18N2O2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (3S)-N,N,3-trimethylpiperidine-1-sulfonamide |
| SMILES | C[C@H]1CCCN(S(=O)(=O)N(C)C)C1 |
| InChI | InChI=1S/C8H18N2O2S/c1-8-5-4-6-10(7-8)13(11,12)9(2)3/h8H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | IOHKIVWBVKYBFH-QMMMGPOBSA-N |
| XLogP | 0.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-N,N,3-trimethylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N,N,3-trimethylpiperidine-1-sulfonamide?
The IUPAC name of (3S)-N,N,3-trimethylpiperidine-1-sulfonamide (CID 51415822) is (3S)-N,N,3-trimethylpiperidine-1-sulfonamide.
What is the SMILES notation for (3S)-N,N,3-trimethylpiperidine-1-sulfonamide?
The canonical SMILES for (3S)-N,N,3-trimethylpiperidine-1-sulfonamide is C[C@H]1CCCN(S(=O)(=O)N(C)C)C1.
What is the InChIKey of (3S)-N,N,3-trimethylpiperidine-1-sulfonamide?
The InChIKey is IOHKIVWBVKYBFH-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H18N2O2S/c1-8-5-4-6-10(7-8)13(11,12)9(2)3/h8H,4-7H2,1-3H3/t8-/m0/s1.
What are the key properties of (3S)-N,N,3-trimethylpiperidine-1-sulfonamide?
(3S)-N,N,3-trimethylpiperidine-1-sulfonamide has a molecular weight of 206.31 g/mol, XLogP of 0.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N,N,3-trimethylpiperidine-1-sulfonamide is sourced from PubChem (CID 51415822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).