About (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide
(3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide (PubChem CID 51415857) has the molecular formula C9H17NO6S3
and a molecular weight of 331.44 g/mol. Its IUPAC name is (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide.
Molecular Properties
| Compound Name | (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide |
| PubChem CID | 51415857 |
| Molecular Formula | C9H17NO6S3 |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide |
| SMILES | C[C@@]1(NS(=O)(=O)[C@H]2CCS(=O)(=O)C2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO6S3/c1-9(3-5-18(13,14)7-9)10-19(15,16)8-2-4-17(11,12)6-8/h8,10H,2-7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | OWUUFSYKDYROKF-DTWKUNHWSA-N |
| XLogP | -1.33 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide?
The IUPAC name of (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide (CID 51415857) is (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide.
What is the SMILES notation for (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide?
The canonical SMILES for (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide is C[C@@]1(NS(=O)(=O)[C@H]2CCS(=O)(=O)C2)CCS(=O)(=O)C1.
What is the InChIKey of (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide?
The InChIKey is OWUUFSYKDYROKF-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H17NO6S3/c1-9(3-5-18(13,14)7-9)10-19(15,16)8-2-4-17(11,12)6-8/h8,10H,2-7H2,1H3/t8-,9+/m0/s1.
What are the key properties of (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide?
(3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide has a molecular weight of 331.44 g/mol, XLogP of -1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-[(3R)-3-methyl-1,1-dioxothiolan-3-yl]-1,1-dioxothiolane-3-sulfonamide is sourced from PubChem (CID 51415857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).