C13H19N3OS — CID 51416464
(1S,3S,4R)-4,7,7-trimethyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]bicyclo[2.2.1]heptan-2-one (PubChem CID 51416464) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is (1S,3S,4R)-4,7,7-trimethyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3S,4R)-4,7,7-trimethyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 51416464 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | (1S,3S,4R)-4,7,7-trimethyl-3-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]bicyclo[2.2.1]heptan-2-one |
| SMILES | Cn1cnnc1S[C@@H]1C(=O)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C13H19N3OS/c1-12(2)8-5-6-13(12,3)10(9(8)17)18-11-15-14-7-16(11)4/h7-8,10H,5-6H2,1-4H3/t8-,10-,13+/m1/s1 |
| InChIKey | YVTAPQZRCFBCLA-JQEORGNBSA-N |
| XLogP | 2.30 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |