C9H7N3O2S — CID 514168
6-(pyridin-3-ylmethyl)-1,3,5-thiadiazine-2,4-dione (PubChem CID 514168) has the molecular formula C9H7N3O2S and a molecular weight of 221.24 g/mol. Its IUPAC name is 6-(pyridin-3-ylmethyl)-1,3,5-thiadiazine-2,4-dione.
| Compound Name | 6-(pyridin-3-ylmethyl)-1,3,5-thiadiazine-2,4-dione |
|---|---|
| PubChem CID | 514168 |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 6-(pyridin-3-ylmethyl)-1,3,5-thiadiazine-2,4-dione |
| SMILES | O=c1nc(Cc2cccnc2)sc(=O)[nH]1 |
| InChI | InChI=1S/C9H7N3O2S/c13-8-11-7(15-9(14)12-8)4-6-2-1-3-10-5-6/h1-3,5H,4H2,(H,12,13,14) |
| InChIKey | OREGPVDUZIESDA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |