About 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene
1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene (PubChem CID 5141695) has the molecular formula C19H30Cl2O2
and a molecular weight of 361.35 g/mol. Its IUPAC name is 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene.
Molecular Properties
| Compound Name | 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene |
| PubChem CID | 5141695 |
| Molecular Formula | C19H30Cl2O2 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene |
| SMILES | COc1cc(CCl)c(OCCC(C)CCCC(C)C)cc1CCl |
| InChI | InChI=1S/C19H30Cl2O2/c1-14(2)6-5-7-15(3)8-9-23-19-11-16(12-20)18(22-4)10-17(19)13-21/h10-11,14-15H,5-9,12-13H2,1-4H3 |
| InChIKey | NLOCNKYNECKGNC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene?
The IUPAC name of 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene (CID 5141695) is 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene.
What is the SMILES notation for 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene?
The canonical SMILES for 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene is COc1cc(CCl)c(OCCC(C)CCCC(C)C)cc1CCl.
What is the InChIKey of 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene?
The InChIKey is NLOCNKYNECKGNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30Cl2O2/c1-14(2)6-5-7-15(3)8-9-23-19-11-16(12-20)18(22-4)10-17(19)13-21/h10-11,14-15H,5-9,12-13H2,1-4H3.
What are the key properties of 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene?
1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene has a molecular weight of 361.35 g/mol, XLogP of 6.40, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(chloromethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene is sourced from PubChem (CID 5141695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).